CAS 1823318-37-1 appears in our catalog under these names: 6–EAPB (hydrochloride), 6-EAPB Hydrochloride, 6-EAPB HCl (1-(Benzofuran-6-yl)-N-ethylpropan-2-amine Hydrochloride), 6-EAPB HCl (1-(Benzofuran-6-yl)-N-ethylpropan-2-amine Hydrochloride) 1.0 mg/ml in Methanol (as free base), 6-EAPB (hydrochloride). Offered by: GLPBio, TRC, LoGiCal, MedChemExpress. Available pack sizes: 1mg, 250mg, 10mg, 1ml, 5mg, 1 mg, 5 mg, 10 mg.
1-(1-benzofuran-6-yl)-N-ethylpropan-2-amine;hydrochloride (CAS 1823318-37-1) is a chemical compound with the molecular formula C13H18ClNO and a molecular weight of 239.74 g/mol. IUPAC name: 1-(1-benzofuran-6-yl)-N-ethylpropan-2-amine;hydrochloride. InChIKey: MUFUSNCKTVRMLR-UHFFFAOYSA-N.
| Molecular formula | C13H18ClNO |
|---|---|
| Molecular weight | 239.74 g/mol |
| IUPAC name | 1-(1-benzofuran-6-yl)-N-ethylpropan-2-amine;hydrochloride |
| InChIKey | MUFUSNCKTVRMLR-UHFFFAOYSA-N |
| SMILES | CCNC(C)CC1=CC2=C(C=C1)C=CO2.Cl |
Computed by PubChem (NCBI)