Products 1823324-70-4
CAS 1823324-70-4 is the registry number for 1-(3,4-Difluoro-5-methoxyphenyl)-2,2-difluoroethanone, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
1-(3,4-difluoro-5-methoxyphenyl)-2,2-difluoroethanone (CAS 1823324-70-4) is a chemical compound with the molecular formula C9H6F4O2 and a molecular weight of 222.14 g/mol. IUPAC name: 1-(3,4-difluoro-5-methoxyphenyl)-2,2-difluoroethanone. InChIKey: NXLLIXPUKXFVAV-UHFFFAOYSA-N.
| Molecular formula | C9H6F4O2 |
|---|---|
| Molecular weight | 222.14 g/mol |
| IUPAC name | 1-(3,4-difluoro-5-methoxyphenyl)-2,2-difluoroethanone |
| InChIKey | NXLLIXPUKXFVAV-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=CC(=C1)C(=O)C(F)F)F)F |
Computed by PubChem (NCBI)