CAS 1823324-99-7 appears in our catalog under these names: 6'-Fluorospiro(azetidine-3,4'-benzo(d)(1,3)oxazin)-2'(1'H)-one, 97%, 6'-Fluoro-1',2'-dihydrospiro(azetidine-3,4'-(3,1)benzoxazine)-2'-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
6-fluorospiro[1H-3,1-benzoxazine-4,3'-azetidine]-2-one (CAS 1823324-99-7) is a chemical compound with the molecular formula C10H9FN2O2 and a molecular weight of 208.19 g/mol. IUPAC name: 6-fluorospiro[1H-3,1-benzoxazine-4,3'-azetidine]-2-one. InChIKey: SONRVANAEBUVIT-UHFFFAOYSA-N.
| Molecular formula | C10H9FN2O2 |
|---|---|
| Molecular weight | 208.19 g/mol |
| IUPAC name | 6-fluorospiro[1H-3,1-benzoxazine-4,3'-azetidine]-2-one |
| InChIKey | SONRVANAEBUVIT-UHFFFAOYSA-N |
| SMILES | C1C2(CN1)C3=C(C=CC(=C3)F)NC(=O)O2 |
Computed by PubChem (NCBI)