CAS 1823346-39-9 is the registry number for 4-Chloro-1-(4-chlorothiazol-2-yl)butan-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-chloro-1-(4-chloro-1,3-thiazol-2-yl)butan-1-one (CAS 1823346-39-9) is a chemical compound with the molecular formula C7H7Cl2NOS and a molecular weight of 224.11 g/mol. IUPAC name: 4-chloro-1-(4-chloro-1,3-thiazol-2-yl)butan-1-one. InChIKey: WNYNZKSJDJDOSV-UHFFFAOYSA-N.
| Molecular formula | C7H7Cl2NOS |
|---|---|
| Molecular weight | 224.11 g/mol |
| IUPAC name | 4-chloro-1-(4-chloro-1,3-thiazol-2-yl)butan-1-one |
| InChIKey | WNYNZKSJDJDOSV-UHFFFAOYSA-N |
| SMILES | C1=C(N=C(S1)C(=O)CCCCl)Cl |
Computed by PubChem (NCBI)