Products 1332531-12-0

CAS 1332531-12-0 is the registry number for (Pyridin-2-ylthio)acetyl chloride hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

2-pyridin-2-ylsulfanylacetyl chloride;hydrochloride (CAS 1332531-12-0) is a chemical compound with the molecular formula C7H7Cl2NOS and a molecular weight of 224.11 g/mol. IUPAC name: 2-pyridin-2-ylsulfanylacetyl chloride;hydrochloride. InChIKey: LHVVNYBCXCRNQD-UHFFFAOYSA-N.

Identity
Molecular formulaC7H7Cl2NOS
Molecular weight224.11 g/mol
IUPAC name2-pyridin-2-ylsulfanylacetyl chloride;hydrochloride
InChIKeyLHVVNYBCXCRNQD-UHFFFAOYSA-N
SMILESC1=CC=NC(=C1)SCC(=O)Cl.Cl

Computed by PubChem (NCBI)