CAS 1332531-12-0 is the registry number for (Pyridin-2-ylthio)acetyl chloride hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
2-pyridin-2-ylsulfanylacetyl chloride;hydrochloride (CAS 1332531-12-0) is a chemical compound with the molecular formula C7H7Cl2NOS and a molecular weight of 224.11 g/mol. IUPAC name: 2-pyridin-2-ylsulfanylacetyl chloride;hydrochloride. InChIKey: LHVVNYBCXCRNQD-UHFFFAOYSA-N.
| Molecular formula | C7H7Cl2NOS |
|---|---|
| Molecular weight | 224.11 g/mol |
| IUPAC name | 2-pyridin-2-ylsulfanylacetyl chloride;hydrochloride |
| InChIKey | LHVVNYBCXCRNQD-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)SCC(=O)Cl.Cl |
Computed by PubChem (NCBI)