Products 27230-51-9

CAS 27230-51-9 is the registry number for 4-Pyridylmercapto acetyl chloride hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

2-pyridin-4-ylsulfanylacetyl chloride;hydrochloride (CAS 27230-51-9) is a chemical compound with the molecular formula C7H7Cl2NOS and a molecular weight of 224.11 g/mol. IUPAC name: 2-pyridin-4-ylsulfanylacetyl chloride;hydrochloride. InChIKey: ONINFWNBKWMUCA-UHFFFAOYSA-N.

Identity
Molecular formulaC7H7Cl2NOS
Molecular weight224.11 g/mol
IUPAC name2-pyridin-4-ylsulfanylacetyl chloride;hydrochloride
InChIKeyONINFWNBKWMUCA-UHFFFAOYSA-N
SMILESC1=CN=CC=C1SCC(=O)Cl.Cl

Computed by PubChem (NCBI)