Products 1823351-33-2

CAS 1823351-33-2 is the registry number for 5-Chloropyrazine-2-sulfonyl chloride, 90%, 90%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

5-chloropyrazine-2-sulfonyl chloride (CAS 1823351-33-2) is a chemical compound with the molecular formula C4H2Cl2N2O2S and a molecular weight of 213.04 g/mol. IUPAC name: 5-chloropyrazine-2-sulfonyl chloride. InChIKey: DDKNVGZUKRJBQY-UHFFFAOYSA-N.

Identity
Molecular formulaC4H2Cl2N2O2S
Molecular weight213.04 g/mol
IUPAC name5-chloropyrazine-2-sulfonyl chloride
InChIKeyDDKNVGZUKRJBQY-UHFFFAOYSA-N
SMILESC1=C(N=CC(=N1)Cl)S(=O)(=O)Cl

Computed by PubChem (NCBI)