CAS 1823351-33-2 is the registry number for 5-Chloropyrazine-2-sulfonyl chloride, 90%, 90%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
5-chloropyrazine-2-sulfonyl chloride (CAS 1823351-33-2) is a chemical compound with the molecular formula C4H2Cl2N2O2S and a molecular weight of 213.04 g/mol. IUPAC name: 5-chloropyrazine-2-sulfonyl chloride. InChIKey: DDKNVGZUKRJBQY-UHFFFAOYSA-N.
| Molecular formula | C4H2Cl2N2O2S |
|---|---|
| Molecular weight | 213.04 g/mol |
| IUPAC name | 5-chloropyrazine-2-sulfonyl chloride |
| InChIKey | DDKNVGZUKRJBQY-UHFFFAOYSA-N |
| SMILES | C1=C(N=CC(=N1)Cl)S(=O)(=O)Cl |
Computed by PubChem (NCBI)