Products 857412-84-1

CAS 857412-84-1 is the registry number for 5-Chloropyrimidine-2-sulfonyl chloride, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.

5-chloropyrimidine-2-sulfonyl chloride (CAS 857412-84-1) is a chemical compound with the molecular formula C4H2Cl2N2O2S and a molecular weight of 213.04 g/mol. IUPAC name: 5-chloropyrimidine-2-sulfonyl chloride. InChIKey: DGOMPXXULGLMRU-UHFFFAOYSA-N.

Identity
Molecular formulaC4H2Cl2N2O2S
Molecular weight213.04 g/mol
IUPAC name5-chloropyrimidine-2-sulfonyl chloride
InChIKeyDGOMPXXULGLMRU-UHFFFAOYSA-N
SMILESC1=C(C=NC(=N1)S(=O)(=O)Cl)Cl

Computed by PubChem (NCBI)