CAS 1823404-28-9 appears in our catalog under these names: Palbociclib Impurity 68, Palbociclib Impurity 52, 5-Bromo-4-chloro-N-cyclopentylpyrimidin-2-amine. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 5mg, 25mg, 10mg, 50mg.
5-bromo-4-chloro-N-cyclopentylpyrimidin-2-amine (CAS 1823404-28-9) is a chemical compound with the molecular formula C9H11BrClN3 and a molecular weight of 276.56 g/mol. IUPAC name: 5-bromo-4-chloro-N-cyclopentylpyrimidin-2-amine. InChIKey: ZJFBJSIIRAXCGF-UHFFFAOYSA-N.
| Molecular formula | C9H11BrClN3 |
|---|---|
| Molecular weight | 276.56 g/mol |
| IUPAC name | 5-bromo-4-chloro-N-cyclopentylpyrimidin-2-amine |
| InChIKey | ZJFBJSIIRAXCGF-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)NC2=NC=C(C(=N2)Cl)Br |
Computed by PubChem (NCBI)