Products 2279123-84-9
CAS 2279123-84-9 is the registry number for [2-(6-Bromoimidazo[1,2-a]pyridin-2-yl)ethyl]amine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-(6-bromoimidazo[1,2-a]pyridin-2-yl)ethanamine;hydrochloride (CAS 2279123-84-9) is a chemical compound with the molecular formula C9H11BrClN3 and a molecular weight of 276.56 g/mol. IUPAC name: 2-(6-bromoimidazo[1,2-a]pyridin-2-yl)ethanamine;hydrochloride. InChIKey: DNWNGAHKINKTPB-UHFFFAOYSA-N.
| Molecular formula | C9H11BrClN3 |
|---|---|
| Molecular weight | 276.56 g/mol |
| IUPAC name | 2-(6-bromoimidazo[1,2-a]pyridin-2-yl)ethanamine;hydrochloride |
| InChIKey | DNWNGAHKINKTPB-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC(=CN2C=C1Br)CCN.Cl |
Computed by PubChem (NCBI)