CAS 1823435-46-6 is the registry number for 1-(4-Bromo-2,6-dichlorophenyl)ethan-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(4-bromo-2,6-dichlorophenyl)ethanone (CAS 1823435-46-6) is a chemical compound with the molecular formula C8H5BrCl2O and a molecular weight of 267.93 g/mol. IUPAC name: 1-(4-bromo-2,6-dichlorophenyl)ethanone. InChIKey: JXVVAHYVRPPKFG-UHFFFAOYSA-N.
| Molecular formula | C8H5BrCl2O |
|---|---|
| Molecular weight | 267.93 g/mol |
| IUPAC name | 1-(4-bromo-2,6-dichlorophenyl)ethanone |
| InChIKey | JXVVAHYVRPPKFG-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C=C(C=C1Cl)Br)Cl |
Computed by PubChem (NCBI)