CAS 81547-72-0 appears in our catalog under these names: 2–Bromo–1–(2,6–dichlorophenyl)ethanone, 2-Bromo-1-(2,6-dichlorophenyl)ethanone 97%, 2-Bromo-1-(2,6-dichlorophenyl)ethanone, 95%. Offered by: GLPBio, Ambeed, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 25g, 10g.
2-bromo-1-(2,6-dichlorophenyl)ethanone (CAS 81547-72-0) is a chemical compound with the molecular formula C8H5BrCl2O and a molecular weight of 267.93 g/mol. IUPAC name: 2-bromo-1-(2,6-dichlorophenyl)ethanone. InChIKey: TWZKNPCXINHGGZ-UHFFFAOYSA-N.
| Molecular formula | C8H5BrCl2O |
|---|---|
| Molecular weight | 267.93 g/mol |
| IUPAC name | 2-bromo-1-(2,6-dichlorophenyl)ethanone |
| InChIKey | TWZKNPCXINHGGZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)C(=O)CBr)Cl |
Computed by PubChem (NCBI)