CAS 1823446-66-7 is the registry number for 2,6-Bis(trifluoromethyl)-3-bromofluorobenzene, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
1-bromo-3-fluoro-2,4-bis(trifluoromethyl)benzene (CAS 1823446-66-7) is a chemical compound with the molecular formula C8H2BrF7 and a molecular weight of 310.99 g/mol. IUPAC name: 1-bromo-3-fluoro-2,4-bis(trifluoromethyl)benzene. InChIKey: ZIXROEIDJMWQNZ-UHFFFAOYSA-N.
| Molecular formula | C8H2BrF7 |
|---|---|
| Molecular weight | 310.99 g/mol |
| IUPAC name | 1-bromo-3-fluoro-2,4-bis(trifluoromethyl)benzene |
| InChIKey | ZIXROEIDJMWQNZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C(F)(F)F)F)C(F)(F)F)Br |
Computed by PubChem (NCBI)