CAS 76437-40-6 appears in our catalog under these names: 2,3,5,6-Tetrafluoro-4-(trifluoromethyl)benzyl bromide, 95%, 4-(Trifluoromethyl)tetrafluorobenzyl bromide, 97%, 2,3,5,6-Tetrafluoro-4-(trifluoromethyl)benzylbromide, 98%. Offered by: Combi-blocks, Fluorochem, Ambeed. Available pack sizes: 5g, 1g, 250mg.
1-(bromomethyl)-2,3,5,6-tetrafluoro-4-(trifluoromethyl)benzene (CAS 76437-40-6) is a chemical compound with the molecular formula C8H2BrF7 and a molecular weight of 310.99 g/mol. IUPAC name: 1-(bromomethyl)-2,3,5,6-tetrafluoro-4-(trifluoromethyl)benzene. InChIKey: WKPYRDRWTNJBQI-UHFFFAOYSA-N.
| Molecular formula | C8H2BrF7 |
|---|---|
| Molecular weight | 310.99 g/mol |
| IUPAC name | 1-(bromomethyl)-2,3,5,6-tetrafluoro-4-(trifluoromethyl)benzene |
| InChIKey | WKPYRDRWTNJBQI-UHFFFAOYSA-N |
| SMILES | C(C1=C(C(=C(C(=C1F)F)C(F)(F)F)F)F)Br |
Computed by PubChem (NCBI)