Products 1823489-59-3

CAS 1823489-59-3 is the registry number for 5-(Trifluoromethyl)-4,5-dihydro-1H-pyrazole-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

5-(trifluoromethyl)-4,5-dihydro-1H-pyrazole-3-carboxylic acid (CAS 1823489-59-3) is a chemical compound with the molecular formula C5H5F3N2O2 and a molecular weight of 182.10 g/mol. IUPAC name: 5-(trifluoromethyl)-4,5-dihydro-1H-pyrazole-3-carboxylic acid. InChIKey: PGUBVFPMCYLZSA-UHFFFAOYSA-N.

Identity
Molecular formulaC5H5F3N2O2
Molecular weight182.10 g/mol
IUPAC name5-(trifluoromethyl)-4,5-dihydro-1H-pyrazole-3-carboxylic acid
InChIKeyPGUBVFPMCYLZSA-UHFFFAOYSA-N
SMILESC1C(NN=C1C(=O)O)C(F)(F)F

Computed by PubChem (NCBI)