Products 1823499-68-8
CAS 1823499-68-8 is the registry number for Methyl 4,6-dimethylpyrazolo[1,5-a]pyrazine-2-carboxylate, 97%. Offered by: Combi-blocks. Available pack sizes: 250mg.
Methyl 4,6-dimethylpyrazolo[1,5-a]pyrazine-2-carboxylate (CAS 1823499-68-8) is a chemical compound with the molecular formula C10H11N3O2 and a molecular weight of 205.21 g/mol. IUPAC name: methyl 4,6-dimethylpyrazolo[1,5-a]pyrazine-2-carboxylate. InChIKey: IFWYTEMBXZVCPE-UHFFFAOYSA-N.
| Molecular formula | C10H11N3O2 |
|---|---|
| Molecular weight | 205.21 g/mol |
| IUPAC name | methyl 4,6-dimethylpyrazolo[1,5-a]pyrazine-2-carboxylate |
| InChIKey | IFWYTEMBXZVCPE-UHFFFAOYSA-N |
| SMILES | CC1=CN2C(=CC(=N2)C(=O)OC)C(=N1)C |
Computed by PubChem (NCBI)