CAS 1823558-00-4 appears in our catalog under these names: 2-Bromo-1-(2-(tert-butyl)thiazol-4-yl)ethanone, 95%, 2-Bromo-1-(2-(tert-butyl)thiazol-4-yl)ethanone. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
2-bromo-1-(2-tert-butyl-1,3-thiazol-4-yl)ethanone (CAS 1823558-00-4) is a chemical compound with the molecular formula C9H12BrNOS and a molecular weight of 262.17 g/mol. IUPAC name: 2-bromo-1-(2-tert-butyl-1,3-thiazol-4-yl)ethanone. InChIKey: GOXNDQHKXCEYAE-UHFFFAOYSA-N.
| Molecular formula | C9H12BrNOS |
|---|---|
| Molecular weight | 262.17 g/mol |
| IUPAC name | 2-bromo-1-(2-tert-butyl-1,3-thiazol-4-yl)ethanone |
| InChIKey | GOXNDQHKXCEYAE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=NC(=CS1)C(=O)CBr |
Computed by PubChem (NCBI)