CAS 911228-70-1 is the registry number for 5-Bromo-N,N-diethyl-2-thiophenecarboxamide, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g.
5-bromo-N,N-diethylthiophene-2-carboxamide (CAS 911228-70-1) is a chemical compound with the molecular formula C9H12BrNOS and a molecular weight of 262.17 g/mol. IUPAC name: 5-bromo-N,N-diethylthiophene-2-carboxamide. InChIKey: QYLSBAVWPGJIAZ-UHFFFAOYSA-N.
| Molecular formula | C9H12BrNOS |
|---|---|
| Molecular weight | 262.17 g/mol |
| IUPAC name | 5-bromo-N,N-diethylthiophene-2-carboxamide |
| InChIKey | QYLSBAVWPGJIAZ-UHFFFAOYSA-N |
| SMILES | CCN(CC)C(=O)C1=CC=C(S1)Br |
Computed by PubChem (NCBI)