Products 1823580-07-9

CAS 1823580-07-9 is the registry number for 2-tert-Butyl 4-methyl 2-azabicyclo(3.1.0)hexane-2,4-dicarboxylate, 98%. Offered by: AmBeed. Available pack sizes: 1g, 250mg.

2-O-tert-butyl 4-O-methyl 2-azabicyclo[3.1.0]hexane-2,4-dicarboxylate (CAS 1823580-07-9) is a chemical compound with the molecular formula C12H19NO4 and a molecular weight of 241.28 g/mol. IUPAC name: 2-O-tert-butyl 4-O-methyl 2-azabicyclo[3.1.0]hexane-2,4-dicarboxylate. InChIKey: UCZGUPXEYDZQBP-UHFFFAOYSA-N.

Identity
Molecular formulaC12H19NO4
Molecular weight241.28 g/mol
IUPAC name2-O-tert-butyl 4-O-methyl 2-azabicyclo[3.1.0]hexane-2,4-dicarboxylate
InChIKeyUCZGUPXEYDZQBP-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CC(C2C1C2)C(=O)OC

Computed by PubChem (NCBI)