CAS 1823580-07-9 is the registry number for 2-tert-Butyl 4-methyl 2-azabicyclo(3.1.0)hexane-2,4-dicarboxylate, 98%. Offered by: AmBeed. Available pack sizes: 1g, 250mg.
2-O-tert-butyl 4-O-methyl 2-azabicyclo[3.1.0]hexane-2,4-dicarboxylate (CAS 1823580-07-9) is a chemical compound with the molecular formula C12H19NO4 and a molecular weight of 241.28 g/mol. IUPAC name: 2-O-tert-butyl 4-O-methyl 2-azabicyclo[3.1.0]hexane-2,4-dicarboxylate. InChIKey: UCZGUPXEYDZQBP-UHFFFAOYSA-N.
| Molecular formula | C12H19NO4 |
|---|---|
| Molecular weight | 241.28 g/mol |
| IUPAC name | 2-O-tert-butyl 4-O-methyl 2-azabicyclo[3.1.0]hexane-2,4-dicarboxylate |
| InChIKey | UCZGUPXEYDZQBP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C2C1C2)C(=O)OC |
Computed by PubChem (NCBI)