CAS 1823776-22-2 appears in our catalog under these names: 5-EAPB Hydrochloride, 5-EAPB HCl (1-(Benzofuran-5-yl)-N-ethylpropan-2-amine Hydrochloride), 5-EAPB HCl (1-(Benzofuran-5-yl)-N-ethylpropan-2-amine Hydrochloride) 1.0 mg/ml in Methanol (as free base), 5–EAPB (hydrochloride), 5-EAPB (hydrochloride). Offered by: TRC, LoGiCal, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 100mg, 10mg, 1ml, 1mg, 5mg, 25mg, 50mg, 1 mg.
1-(1-benzofuran-5-yl)-N-ethylpropan-2-amine;hydrochloride (CAS 1823776-22-2) is a chemical compound with the molecular formula C13H18ClNO and a molecular weight of 239.74 g/mol. IUPAC name: 1-(1-benzofuran-5-yl)-N-ethylpropan-2-amine;hydrochloride. InChIKey: YJEXOIDIYJUVNS-UHFFFAOYSA-N.
| Molecular formula | C13H18ClNO |
|---|---|
| Molecular weight | 239.74 g/mol |
| IUPAC name | 1-(1-benzofuran-5-yl)-N-ethylpropan-2-amine;hydrochloride |
| InChIKey | YJEXOIDIYJUVNS-UHFFFAOYSA-N |
| SMILES | CCNC(C)CC1=CC2=C(C=C1)OC=C2.Cl |
Computed by PubChem (NCBI)