Products 1823778-17-1
CAS 1823778-17-1 is the registry number for 1-(2-Chloro-5-(trifluoromethyl)phenyl)-2,2-difluoroethan-1-one, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-[2-chloro-5-(trifluoromethyl)phenyl]-2,2-difluoroethanone (CAS 1823778-17-1) is a chemical compound with the molecular formula C9H4ClF5O and a molecular weight of 258.57 g/mol. IUPAC name: 1-[2-chloro-5-(trifluoromethyl)phenyl]-2,2-difluoroethanone. InChIKey: TXNOGRCSDSANTM-UHFFFAOYSA-N.
| Molecular formula | C9H4ClF5O |
|---|---|
| Molecular weight | 258.57 g/mol |
| IUPAC name | 1-[2-chloro-5-(trifluoromethyl)phenyl]-2,2-difluoroethanone |
| InChIKey | TXNOGRCSDSANTM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)C(=O)C(F)F)Cl |
Computed by PubChem (NCBI)