Products 781-97-5
CAS 781-97-5 is the registry number for 1-(4-Chlorophenyl)-2,2,3,3,3-pentafluoro-propan-1-one, 98%. Offered by: Fluorochem. Available pack sizes: 1g.
1-(4-chlorophenyl)-2,2,3,3,3-pentafluoropropan-1-one (CAS 781-97-5) is a chemical compound with the molecular formula C9H4ClF5O and a molecular weight of 258.57 g/mol. IUPAC name: 1-(4-chlorophenyl)-2,2,3,3,3-pentafluoropropan-1-one. InChIKey: SVCOUMOZVHFUSG-UHFFFAOYSA-N.
| Molecular formula | C9H4ClF5O |
|---|---|
| Molecular weight | 258.57 g/mol |
| IUPAC name | 1-(4-chlorophenyl)-2,2,3,3,3-pentafluoropropan-1-one |
| InChIKey | SVCOUMOZVHFUSG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)C(C(F)(F)F)(F)F)Cl |
Computed by PubChem (NCBI)