CAS 1823898-82-3 is the registry number for 3,5-Bis(trifluoromethyl)pyrazin-2-amine, 95%. Offered by: AmBeed. Available pack sizes: 1g.
3,5-bis(trifluoromethyl)pyrazin-2-amine (CAS 1823898-82-3) is a chemical compound with the molecular formula C6H3F6N3 and a molecular weight of 231.10 g/mol. IUPAC name: 3,5-bis(trifluoromethyl)pyrazin-2-amine. InChIKey: HWPILMLGOLUPOC-UHFFFAOYSA-N.
| Molecular formula | C6H3F6N3 |
|---|---|
| Molecular weight | 231.10 g/mol |
| IUPAC name | 3,5-bis(trifluoromethyl)pyrazin-2-amine |
| InChIKey | HWPILMLGOLUPOC-UHFFFAOYSA-N |
| SMILES | C1=C(N=C(C(=N1)N)C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)