CAS 369-22-2 appears in our catalog under these names: 2,4,6-Tris(difluoromethyl)-1,3,5-triazine, 95%, 2,4,6-Tris(difluoromethyl)-1,3,5-triazine. Offered by: Combi-blocks, TRC. Available pack sizes: 5g, 1g, 100mg, 500mg, 50mg.
2,4,6-tris(difluoromethyl)-1,3,5-triazine (CAS 369-22-2) is a chemical compound with the molecular formula C6H3F6N3 and a molecular weight of 231.10 g/mol. IUPAC name: 2,4,6-tris(difluoromethyl)-1,3,5-triazine. InChIKey: MVQIQWCWIMQVFD-UHFFFAOYSA-N.
| Molecular formula | C6H3F6N3 |
|---|---|
| Molecular weight | 231.10 g/mol |
| IUPAC name | 2,4,6-tris(difluoromethyl)-1,3,5-triazine |
| InChIKey | MVQIQWCWIMQVFD-UHFFFAOYSA-N |
| SMILES | C1(=NC(=NC(=N1)C(F)F)C(F)F)C(F)F |
Computed by PubChem (NCBI)