CAS 1823913-86-5 appears in our catalog under these names: 2-chloro-4,5,6-trimethylnicotinamide, 95%, 2-Chloro-4,5,6-trimethylnicotinamide, 97%, 2-Chloro-4,5,6-trimethylpyridine-3-carboxamide. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 5g, 250mg, 1g, 50mg, 0,5g.
2-chloro-4,5,6-trimethylpyridine-3-carboxamide (CAS 1823913-86-5) is a chemical compound with the molecular formula C9H11ClN2O and a molecular weight of 198.65 g/mol. IUPAC name: 2-chloro-4,5,6-trimethylpyridine-3-carboxamide. InChIKey: UEDIDBHFDDKPFO-UHFFFAOYSA-N.
| Molecular formula | C9H11ClN2O |
|---|---|
| Molecular weight | 198.65 g/mol |
| IUPAC name | 2-chloro-4,5,6-trimethylpyridine-3-carboxamide |
| InChIKey | UEDIDBHFDDKPFO-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(N=C1C)Cl)C(=O)N)C |
Computed by PubChem (NCBI)