CAS 1823939-03-2 is the registry number for 4-(Bicyclo[1.1.1]pentan-1-yl)phenol, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 250mg, 100mg.
4-(1-bicyclo[1.1.1]pentanyl)phenol (CAS 1823939-03-2) is a chemical compound with the molecular formula C11H12O and a molecular weight of 160.21 g/mol. IUPAC name: 4-(1-bicyclo[1.1.1]pentanyl)phenol. InChIKey: CWEMDMRHGJZJIR-UHFFFAOYSA-N.
| Molecular formula | C11H12O |
|---|---|
| Molecular weight | 160.21 g/mol |
| IUPAC name | 4-(1-bicyclo[1.1.1]pentanyl)phenol |
| InChIKey | CWEMDMRHGJZJIR-UHFFFAOYSA-N |
| SMILES | C1C2CC1(C2)C3=CC=C(C=C3)O |
Computed by PubChem (NCBI)