Products 1823957-69-2
CAS 1823957-69-2 is the registry number for tert-Butyl 3-bromo-1,2,3,6-tetrahydropyridine-1-carboxylate, 95%. Offered by: AmBeed. Available pack sizes: 1g.
Tert-butyl 3-bromo-3,6-dihydro-2H-pyridine-1-carboxylate (CAS 1823957-69-2) is a chemical compound with the molecular formula C10H16BrNO2 and a molecular weight of 262.14 g/mol. IUPAC name: tert-butyl 3-bromo-3,6-dihydro-2H-pyridine-1-carboxylate. InChIKey: KMPZGCZOGMLILR-UHFFFAOYSA-N.
| Molecular formula | C10H16BrNO2 |
|---|---|
| Molecular weight | 262.14 g/mol |
| IUPAC name | tert-butyl 3-bromo-3,6-dihydro-2H-pyridine-1-carboxylate |
| InChIKey | KMPZGCZOGMLILR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC=CC(C1)Br |
Computed by PubChem (NCBI)