CAS 50309-53-0 appears in our catalog under these names: Dopamine Impurity 42 HBr, 4-(2-(Dimethylamino)ethyl)benzene-1,2-diol Hydrobromide. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 500mg, 0,5g, 50mg.
4-[2-(dimethylamino)ethyl]benzene-1,2-diol;hydrobromide (CAS 50309-53-0) is a chemical compound with the molecular formula C10H16BrNO2 and a molecular weight of 262.14 g/mol. IUPAC name: 4-[2-(dimethylamino)ethyl]benzene-1,2-diol;hydrobromide. InChIKey: BJOVIRHSZCTSQR-UHFFFAOYSA-N.
| Molecular formula | C10H16BrNO2 |
|---|---|
| Molecular weight | 262.14 g/mol |
| IUPAC name | 4-[2-(dimethylamino)ethyl]benzene-1,2-diol;hydrobromide |
| InChIKey | BJOVIRHSZCTSQR-UHFFFAOYSA-N |
| SMILES | CN(C)CCC1=CC(=C(C=C1)O)O.Br |
Computed by PubChem (NCBI)