CAS 1823967-24-3 appears in our catalog under these names: Ethyl 5-(trifluoromethyl)-1,3,4-thiadiazole-2-carboxylate, 98%, Ethyl 5-(trifluoromethyl)-1,3,4-thiadiazole-2-carboxylate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 5g, 50mg, 0,5g.
Ethyl 5-(trifluoromethyl)-1,3,4-thiadiazole-2-carboxylate (CAS 1823967-24-3) is a chemical compound with the molecular formula C6H5F3N2O2S and a molecular weight of 226.18 g/mol. IUPAC name: ethyl 5-(trifluoromethyl)-1,3,4-thiadiazole-2-carboxylate. InChIKey: CUMUJMJWAUMTRU-UHFFFAOYSA-N.
| Molecular formula | C6H5F3N2O2S |
|---|---|
| Molecular weight | 226.18 g/mol |
| IUPAC name | ethyl 5-(trifluoromethyl)-1,3,4-thiadiazole-2-carboxylate |
| InChIKey | CUMUJMJWAUMTRU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NN=C(S1)C(F)(F)F |
Computed by PubChem (NCBI)