Products 361389-88-0
CAS 361389-88-0 is the registry number for 2-(Methylsulfonyl)-5-(trifluoromethyl)pyrimidine 98%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
2-methylsulfonyl-5-(trifluoromethyl)pyrimidine (CAS 361389-88-0) is a chemical compound with the molecular formula C6H5F3N2O2S and a molecular weight of 226.18 g/mol. IUPAC name: 2-methylsulfonyl-5-(trifluoromethyl)pyrimidine. InChIKey: NGCALTDFVDXPIU-UHFFFAOYSA-N.
| Molecular formula | C6H5F3N2O2S |
|---|---|
| Molecular weight | 226.18 g/mol |
| IUPAC name | 2-methylsulfonyl-5-(trifluoromethyl)pyrimidine |
| InChIKey | NGCALTDFVDXPIU-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=NC=C(C=N1)C(F)(F)F |
Computed by PubChem (NCBI)