CAS 1823980-89-7 is the registry number for 1-Bromonaphthalene-2,7-diamine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-bromonaphthalene-2,7-diamine (CAS 1823980-89-7) is a chemical compound with the molecular formula C10H9BrN2 and a molecular weight of 237.10 g/mol. IUPAC name: 1-bromonaphthalene-2,7-diamine. InChIKey: VFICJQIMHLAQFT-UHFFFAOYSA-N.
| Molecular formula | C10H9BrN2 |
|---|---|
| Molecular weight | 237.10 g/mol |
| IUPAC name | 1-bromonaphthalene-2,7-diamine |
| InChIKey | VFICJQIMHLAQFT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC2=C1C=CC(=C2Br)N)N |
Computed by PubChem (NCBI)