CAS 1824069-82-0 is the registry number for Ethyl 2-bromo-4-methyl-4H-pyrrolo[2,3-d]thiazole-5-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 2-bromo-4-methylpyrrolo[2,3-d][1,3]thiazole-5-carboxylate (CAS 1824069-82-0) is a chemical compound with the molecular formula C9H9BrN2O2S and a molecular weight of 289.15 g/mol. IUPAC name: ethyl 2-bromo-4-methylpyrrolo[2,3-d][1,3]thiazole-5-carboxylate. InChIKey: KXIWQCRIZCNLEV-UHFFFAOYSA-N.
| Molecular formula | C9H9BrN2O2S |
|---|---|
| Molecular weight | 289.15 g/mol |
| IUPAC name | ethyl 2-bromo-4-methylpyrrolo[2,3-d][1,3]thiazole-5-carboxylate |
| InChIKey | KXIWQCRIZCNLEV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(N1C)N=C(S2)Br |
Computed by PubChem (NCBI)