Products 2253632-93-6
CAS 2253632-93-6 is the registry number for methyl 4-bromo-3-(carbamothioylamino)benzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
Methyl 4-bromo-3-(carbamothioylamino)benzoate (CAS 2253632-93-6) is a chemical compound with the molecular formula C9H9BrN2O2S and a molecular weight of 289.15 g/mol. IUPAC name: methyl 4-bromo-3-(carbamothioylamino)benzoate. InChIKey: LVHNGAUAGDYSFH-UHFFFAOYSA-N.
| Molecular formula | C9H9BrN2O2S |
|---|---|
| Molecular weight | 289.15 g/mol |
| IUPAC name | methyl 4-bromo-3-(carbamothioylamino)benzoate |
| InChIKey | LVHNGAUAGDYSFH-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1)Br)NC(=S)N |
Computed by PubChem (NCBI)