Products 1824150-16-4
CAS 1824150-16-4 is the registry number for tert-Butyl 5,6-dihydro-[1,2,4]triazolo[1,5-a]pyrazine-7(8H)-carboxylate, 97%. Offered by: Ambeed, BLDpharm, Chemat. Available pack sizes: 100mg, 250mg, 1g, 50mg.
Tert-butyl 6,8-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrazine-7-carboxylate (CAS 1824150-16-4) is a chemical compound with the molecular formula C10H16N4O2 and a molecular weight of 224.26 g/mol. IUPAC name: tert-butyl 6,8-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrazine-7-carboxylate. InChIKey: QEXKSFDJUXVRIA-UHFFFAOYSA-N.
| Molecular formula | C10H16N4O2 |
|---|---|
| Molecular weight | 224.26 g/mol |
| IUPAC name | tert-butyl 6,8-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrazine-7-carboxylate |
| InChIKey | QEXKSFDJUXVRIA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN2C(=NC=N2)C1 |
Computed by PubChem (NCBI)