Products 182416-13-3

CAS 182416-13-3 is the registry number for 3-(2-Pyrimidinyl)-1-piperidinecarboxylic acid 1,1-dimethylethyl ester, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Tert-butyl 3-pyrimidin-2-ylpiperidine-1-carboxylate (CAS 182416-13-3) is a chemical compound with the molecular formula C14H21N3O2 and a molecular weight of 263.34 g/mol. IUPAC name: tert-butyl 3-pyrimidin-2-ylpiperidine-1-carboxylate. InChIKey: WQRSHVALUVNZBH-UHFFFAOYSA-N.

Identity
Molecular formulaC14H21N3O2
Molecular weight263.34 g/mol
IUPAC nametert-butyl 3-pyrimidin-2-ylpiperidine-1-carboxylate
InChIKeyWQRSHVALUVNZBH-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCCC(C1)C2=NC=CC=N2

Computed by PubChem (NCBI)