Products 1824283-31-9
CAS 1824283-31-9 appears in our catalog under these names: 3,5-Bis(difluoromethyl)benzoic acid, 95%, 95%, 3,5-Bis(difluoromethyl)benzoic acid, 95%. Offered by: Chemat, Ambeed, BLDpharm, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 50mg.
3,5-bis(difluoromethyl)benzoic acid (CAS 1824283-31-9) is a chemical compound with the molecular formula C9H6F4O2 and a molecular weight of 222.14 g/mol. IUPAC name: 3,5-bis(difluoromethyl)benzoic acid. InChIKey: QDDWMFGBUHIIMT-UHFFFAOYSA-N.
| Molecular formula | C9H6F4O2 |
|---|---|
| Molecular weight | 222.14 g/mol |
| IUPAC name | 3,5-bis(difluoromethyl)benzoic acid |
| InChIKey | QDDWMFGBUHIIMT-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(F)F)C(=O)O)C(F)F |
Computed by PubChem (NCBI)