Products 1824284-85-6
CAS 1824284-85-6 is the registry number for 2-Bromo-1-(bromomethyl)-3-(2,2,2-trifluoroethoxy)benzene. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-bromo-1-(bromomethyl)-3-(2,2,2-trifluoroethoxy)benzene (CAS 1824284-85-6) is a chemical compound with the molecular formula C9H7Br2F3O and a molecular weight of 347.95 g/mol. IUPAC name: 2-bromo-1-(bromomethyl)-3-(2,2,2-trifluoroethoxy)benzene. InChIKey: APZFVIUDWUSNDI-UHFFFAOYSA-N.
| Molecular formula | C9H7Br2F3O |
|---|---|
| Molecular weight | 347.95 g/mol |
| IUPAC name | 2-bromo-1-(bromomethyl)-3-(2,2,2-trifluoroethoxy)benzene |
| InChIKey | APZFVIUDWUSNDI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)OCC(F)(F)F)Br)CBr |
Computed by PubChem (NCBI)