CAS 1824456-74-7 is the registry number for tert-Butyl 6-(2,2,2-trifluoroacetyl)-3,6-diazabicyclo[3.2.1]octane-3-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 6-(2,2,2-trifluoroacetyl)-3,6-diazabicyclo[3.2.1]octane-3-carboxylate (CAS 1824456-74-7) is a chemical compound with the molecular formula C13H19F3N2O3 and a molecular weight of 308.30 g/mol. IUPAC name: tert-butyl 6-(2,2,2-trifluoroacetyl)-3,6-diazabicyclo[3.2.1]octane-3-carboxylate. InChIKey: YLNWHXSSTWQZGR-UHFFFAOYSA-N.
| Molecular formula | C13H19F3N2O3 |
|---|---|
| Molecular weight | 308.30 g/mol |
| IUPAC name | tert-butyl 6-(2,2,2-trifluoroacetyl)-3,6-diazabicyclo[3.2.1]octane-3-carboxylate |
| InChIKey | YLNWHXSSTWQZGR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2CC(C1)N(C2)C(=O)C(F)(F)F |
Computed by PubChem (NCBI)