CAS 1932230-02-8 is the registry number for N-(Endo-7-boc-7-azabicyclo[2.2.1]heptan-2-yl) trifluoroacetamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Tert-butyl 2-[(2,2,2-trifluoroacetyl)amino]-7-azabicyclo[2.2.1]heptane-7-carboxylate (CAS 1932230-02-8) is a chemical compound with the molecular formula C13H19F3N2O3 and a molecular weight of 308.30 g/mol. IUPAC name: tert-butyl 2-[(2,2,2-trifluoroacetyl)amino]-7-azabicyclo[2.2.1]heptane-7-carboxylate. InChIKey: OSEBHMPQLPAGFK-UHFFFAOYSA-N.
| Molecular formula | C13H19F3N2O3 |
|---|---|
| Molecular weight | 308.30 g/mol |
| IUPAC name | tert-butyl 2-[(2,2,2-trifluoroacetyl)amino]-7-azabicyclo[2.2.1]heptane-7-carboxylate |
| InChIKey | OSEBHMPQLPAGFK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C2CCC1C(C2)NC(=O)C(F)(F)F |
Computed by PubChem (NCBI)