Products 1824467-52-8

CAS 1824467-52-8 is the registry number for tert-Butyl N-(2-hydroxy-3-sulfanylpropyl)carbamate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Tert-butyl N-(2-hydroxy-3-sulfanylpropyl)carbamate (CAS 1824467-52-8) is a chemical compound with the molecular formula C8H17NO3S and a molecular weight of 207.29 g/mol. IUPAC name: tert-butyl N-(2-hydroxy-3-sulfanylpropyl)carbamate. InChIKey: KAJRPSXMBYHETN-UHFFFAOYSA-N.

Identity
Molecular formulaC8H17NO3S
Molecular weight207.29 g/mol
IUPAC nametert-butyl N-(2-hydroxy-3-sulfanylpropyl)carbamate
InChIKeyKAJRPSXMBYHETN-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NCC(CS)O

Computed by PubChem (NCBI)