CAS 1824590-18-2 appears in our catalog under these names: 2,2-Dimethyl-1,2-dihydroquinolin-4-ol hydrochloride, 95%, 2,2-Dimethyl-1,2-dihydroquinolin-4-ol hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
2,2-dimethyl-1H-quinolin-4-ol;hydrochloride (CAS 1824590-18-2) is a chemical compound with the molecular formula C11H14ClNO and a molecular weight of 211.69 g/mol. IUPAC name: 2,2-dimethyl-1H-quinolin-4-ol;hydrochloride. InChIKey: NERYKRSKHXXBEZ-UHFFFAOYSA-N.
| Molecular formula | C11H14ClNO |
|---|---|
| Molecular weight | 211.69 g/mol |
| IUPAC name | 2,2-dimethyl-1H-quinolin-4-ol;hydrochloride |
| InChIKey | NERYKRSKHXXBEZ-UHFFFAOYSA-N |
| SMILES | CC1(C=C(C2=CC=CC=C2N1)O)C.Cl |
Computed by PubChem (NCBI)