Products 1824592-98-4

CAS 1824592-98-4 is the registry number for 8-Chloro-6-fluorochromane-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

8-chloro-6-fluoro-3,4-dihydro-2H-chromene-3-carboxylic acid (CAS 1824592-98-4) is a chemical compound with the molecular formula C10H8ClFO3 and a molecular weight of 230.62 g/mol. IUPAC name: 8-chloro-6-fluoro-3,4-dihydro-2H-chromene-3-carboxylic acid. InChIKey: GZVOQNVNSJIYFY-UHFFFAOYSA-N.

Identity
Molecular formulaC10H8ClFO3
Molecular weight230.62 g/mol
IUPAC name8-chloro-6-fluoro-3,4-dihydro-2H-chromene-3-carboxylic acid
InChIKeyGZVOQNVNSJIYFY-UHFFFAOYSA-N
SMILESC1C(COC2=C1C=C(C=C2Cl)F)C(=O)O

Computed by PubChem (NCBI)