Products 868373-87-9
CAS 868373-87-9 appears in our catalog under these names: Methyl 3-(2-chloro-6-fluorophenyl)-3-oxopropanoate, 95%, Methyl 3-(2-chloro-6-fluorophenyl)-3-oxopropanoate. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 5g, 100mg.
Methyl 3-(2-chloro-6-fluorophenyl)-3-oxopropanoate (CAS 868373-87-9) is a chemical compound with the molecular formula C10H8ClFO3 and a molecular weight of 230.62 g/mol. IUPAC name: methyl 3-(2-chloro-6-fluorophenyl)-3-oxopropanoate. InChIKey: GXGZQUYKBHOIML-UHFFFAOYSA-N.
| Molecular formula | C10H8ClFO3 |
|---|---|
| Molecular weight | 230.62 g/mol |
| IUPAC name | methyl 3-(2-chloro-6-fluorophenyl)-3-oxopropanoate |
| InChIKey | GXGZQUYKBHOIML-UHFFFAOYSA-N |
| SMILES | COC(=O)CC(=O)C1=C(C=CC=C1Cl)F |
Computed by PubChem (NCBI)