CAS 1824624-21-6 is the registry number for 1-(4-Hydroxyphenyl)-2,3-dihydroxypropan-1-one. Offered by: MedChemExpress. Available pack sizes: Get quote.
2,3-dihydroxy-1-(4-hydroxyphenyl)propan-1-one (CAS 1824624-21-6) is a chemical compound with the molecular formula C9H10O4 and a molecular weight of 182.17 g/mol. IUPAC name: 2,3-dihydroxy-1-(4-hydroxyphenyl)propan-1-one. InChIKey: GIDCYTNGBLUMQG-UHFFFAOYSA-N.
| Molecular formula | C9H10O4 |
|---|---|
| Molecular weight | 182.17 g/mol |
| IUPAC name | 2,3-dihydroxy-1-(4-hydroxyphenyl)propan-1-one |
| InChIKey | GIDCYTNGBLUMQG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)C(CO)O)O |
Computed by PubChem (NCBI)