CAS 1824658-18-5 is the registry number for 5,6-Dihydroxy-2H-1,3-benzoxathiol-2-one. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
5,6-dihydroxy-1,3-benzoxathiol-2-one (CAS 1824658-18-5) is a chemical compound with the molecular formula C7H4O4S and a molecular weight of 184.17 g/mol. IUPAC name: 5,6-dihydroxy-1,3-benzoxathiol-2-one. InChIKey: IFEMIQVVCZRAKE-UHFFFAOYSA-N.
| Molecular formula | C7H4O4S |
|---|---|
| Molecular weight | 184.17 g/mol |
| IUPAC name | 5,6-dihydroxy-1,3-benzoxathiol-2-one |
| InChIKey | IFEMIQVVCZRAKE-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC2=C1OC(=O)S2)O)O |
Computed by PubChem (NCBI)