Products 1824662-33-0

CAS 1824662-33-0 is the registry number for methyl 3-chloro-2-ethylbenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

Methyl 3-chloro-2-ethylbenzoate (CAS 1824662-33-0) is a chemical compound with the molecular formula C10H11ClO2 and a molecular weight of 198.64 g/mol. IUPAC name: methyl 3-chloro-2-ethylbenzoate. InChIKey: UQJCWHVNXYFEPR-UHFFFAOYSA-N.

Identity
Molecular formulaC10H11ClO2
Molecular weight198.64 g/mol
IUPAC namemethyl 3-chloro-2-ethylbenzoate
InChIKeyUQJCWHVNXYFEPR-UHFFFAOYSA-N
SMILESCCC1=C(C=CC=C1Cl)C(=O)OC

Computed by PubChem (NCBI)