CAS 182624-54-0 appears in our catalog under these names: Estradiol Valerate Impurity 1 (17-epi Estradiol Valerate), 17-epi Estradiol Valerate, Estradiol Valerate Impurity 17, 17-epi-Estradiol Valerate (17alpha-Estradiol Valerate), 17α-Estradiol 17-valerate. Offered by: Chemat Brand, Hubei YoungXin, Mikromol, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 2mg, 1mg.
[(8R,9S,13S,14S,17R)-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] pentanoate (CAS 182624-54-0) is a chemical compound with the molecular formula C23H32O3 and a molecular weight of 356.5 g/mol. IUPAC name: [(8R,9S,13S,14S,17R)-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] pentanoate. InChIKey: RSEPBGGWRJCQGY-VZWAGXQNSA-N.
| Molecular formula | C23H32O3 |
|---|---|
| Molecular weight | 356.5 g/mol |
| IUPAC name | [(8R,9S,13S,14S,17R)-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] pentanoate |
| InChIKey | RSEPBGGWRJCQGY-VZWAGXQNSA-N |
| SMILES | CCCCC(=O)O[C@@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CCC4=C3C=CC(=C4)O)C |
Computed by PubChem (NCBI)