CAS 21881-45-8 appears in our catalog under these names: Estradiol Valerate EP Impurity B, Estradiol Valerate EP Impurity B (3-Valerate Estradiol), Estradiol Valerate Impurity 2 (Estradiol Valerate EP Impurity B), Estradiol 3-Valerate, >95% (HPLC), 17beta-Hydroxyestra-1,3,5(10)-trien-3-yl Pentanoate (Estradiol 3-Valerate). Offered by: Chemat Brand, Hubei YoungXin, TRC, Mikromol, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 500mg.
[(8R,9S,13S,14S,17S)-17-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] pentanoate (CAS 21881-45-8) is a chemical compound with the molecular formula C23H32O3 and a molecular weight of 356.5 g/mol. IUPAC name: [(8R,9S,13S,14S,17S)-17-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] pentanoate. InChIKey: IFDPLCRWEBQEAJ-RBRWEJTLSA-N.
| Molecular formula | C23H32O3 |
|---|---|
| Molecular weight | 356.5 g/mol |
| IUPAC name | [(8R,9S,13S,14S,17S)-17-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] pentanoate |
| InChIKey | IFDPLCRWEBQEAJ-RBRWEJTLSA-N |
| SMILES | CCCCC(=O)OC1=CC2=C(C=C1)[C@H]3CC[C@]4([C@H]([C@@H]3CC2)CC[C@@H]4O)C |
Computed by PubChem (NCBI)