CAS 182628-02-0 appears in our catalog under these names: Brimonidine Tartrate Impurity 4, Brimonidine Impurity 13, N-(5-Bromoquinoxalin-6-yl)cyanamide, ((5-Bromoquinoxalin-6-yl)amino)formonitrile. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 5g, 0,5g, 50mg.
(5-bromoquinoxalin-6-yl)cyanamide (CAS 182628-02-0) is a chemical compound with the molecular formula C9H5BrN4 and a molecular weight of 249.07 g/mol. IUPAC name: (5-bromoquinoxalin-6-yl)cyanamide. InChIKey: BDNRNAIKQPMCFL-UHFFFAOYSA-N.
| Molecular formula | C9H5BrN4 |
|---|---|
| Molecular weight | 249.07 g/mol |
| IUPAC name | (5-bromoquinoxalin-6-yl)cyanamide |
| InChIKey | BDNRNAIKQPMCFL-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC=CN=C2C(=C1NC#N)Br |
Computed by PubChem (NCBI)