CAS 328281-85-2 appears in our catalog under these names: 5-(3-Bromophenyl)-1H-1,2,4-triazole-3-carbonitrile, 95%, 5-(3-Bromophenyl)-1H-1,2,4-triazole-3-carbonitrile. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 0,5g, 50mg.
5-(3-bromophenyl)-1H-1,2,4-triazole-3-carbonitrile (CAS 328281-85-2) is a chemical compound with the molecular formula C9H5BrN4 and a molecular weight of 249.07 g/mol. IUPAC name: 5-(3-bromophenyl)-1H-1,2,4-triazole-3-carbonitrile. InChIKey: QELMUXYSPFQBAE-UHFFFAOYSA-N.
| Molecular formula | C9H5BrN4 |
|---|---|
| Molecular weight | 249.07 g/mol |
| IUPAC name | 5-(3-bromophenyl)-1H-1,2,4-triazole-3-carbonitrile |
| InChIKey | QELMUXYSPFQBAE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)C2=NC(=NN2)C#N |
Computed by PubChem (NCBI)